C23H29N2NaO6S2+2 — CID 86639981
sodium 3-[2-[(E)-2-anilinoethenyl]-3-methyl-1-(3-sulfopropyl)indol-1-ium-3-yl]propane-1-sulfonic acid (PubChem CID 86639981) has the molecular formula C23H29N2NaO6S2+2 and a molecular weight of 516.62 g/mol. Its IUPAC name is sodium 3-[2-[(E)-2-anilinoethenyl]-3-methyl-1-(3-sulfopropyl)indol-1-ium-3-yl]propane-1-sulfonic acid.
| Compound Name | sodium 3-[2-[(E)-2-anilinoethenyl]-3-methyl-1-(3-sulfopropyl)indol-1-ium-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 86639981 |
| Molecular Formula | C23H29N2NaO6S2+2 |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | sodium 3-[2-[(E)-2-anilinoethenyl]-3-methyl-1-(3-sulfopropyl)indol-1-ium-3-yl]propane-1-sulfonic acid |
| SMILES | CC1(CCCS(=O)(=O)O)C(/C=C/Nc2ccccc2)=[N+](CCCS(=O)(=O)O)c2ccccc21.[Na+] |
| InChI | InChI=1S/C23H28N2O6S2.Na/c1-23(14-7-17-32(26,27)28)20-11-5-6-12-21(20)25(16-8-18-33(29,30)31)22(23)13-15-24-19-9-3-2-4-10-19;/h2-6,9-13,15H,7-8,14,16-18H2,1H3,(H2,26,27,28,29,30,31);/q;+1/p+1 |
| InChIKey | WLRATCFNDBTMPW-UHFFFAOYSA-O |
| XLogP | 0.62 |
| TPSA | 123.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|