C30H30N3O5S+ — CID 123943027
3-[2-(2-anilinoethenyl)-5-[(1,3-dioxoisoindol-2-yl)methyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 123943027) has the molecular formula C30H30N3O5S+ and a molecular weight of 544.65 g/mol. Its IUPAC name is 3-[2-(2-anilinoethenyl)-5-[(1,3-dioxoisoindol-2-yl)methyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-(2-anilinoethenyl)-5-[(1,3-dioxoisoindol-2-yl)methyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 123943027 |
| Molecular Formula | C30H30N3O5S+ |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | 3-[2-(2-anilinoethenyl)-5-[(1,3-dioxoisoindol-2-yl)methyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | CC1(C)C(C=CNc2ccccc2)=[N+](CCCS(=O)(=O)O)c2ccc(CN3C(=O)c4ccccc4C3=O)cc21 |
| InChI | InChI=1S/C30H29N3O5S/c1-30(2)25-19-21(20-33-28(34)23-11-6-7-12-24(23)29(33)35)13-14-26(25)32(17-8-18-39(36,37)38)27(30)15-16-31-22-9-4-3-5-10-22/h3-7,9-16,19H,8,17-18,20H2,1-2H3,(H,36,37,38)/p+1 |
| InChIKey | DGHQKBSVIIKVAW-UHFFFAOYSA-O |
| XLogP | 4.76 |
| TPSA | 106.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|