C22H25N2O5S+ — CID 123283424
2-(2-anilinoethenyl)-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-4-carboxylic acid (PubChem CID 123283424) has the molecular formula C22H25N2O5S+ and a molecular weight of 429.52 g/mol. Its IUPAC name is 2-(2-anilinoethenyl)-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-4-carboxylic acid.
| Compound Name | 2-(2-anilinoethenyl)-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-4-carboxylic acid |
|---|---|
| PubChem CID | 123283424 |
| Molecular Formula | C22H25N2O5S+ |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 2-(2-anilinoethenyl)-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-4-carboxylic acid |
| SMILES | CC1(C)C(C=CNc2ccccc2)=[N+](CCCS(=O)(=O)O)c2cccc(C(=O)O)c21 |
| InChI | InChI=1S/C22H24N2O5S/c1-22(2)19(12-13-23-16-8-4-3-5-9-16)24(14-7-15-30(27,28)29)18-11-6-10-17(20(18)22)21(25)26/h3-6,8-13H,7,14-15H2,1-2H3,(H2,25,26,27,28,29)/p+1 |
| InChIKey | MURQQJQIZXQKQR-UHFFFAOYSA-O |
| XLogP | 3.66 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|