C21H23N3O5S — CID 177388251
3-[2-[(E)-2-anilinoethenyl]-3,3-dimethyl-5-nitroindol-1-ium-1-yl]propane-1-sulfonate (PubChem CID 177388251) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is 3-[2-[(E)-2-anilinoethenyl]-3,3-dimethyl-5-nitroindol-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[(E)-2-anilinoethenyl]-3,3-dimethyl-5-nitroindol-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 177388251 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 3-[2-[(E)-2-anilinoethenyl]-3,3-dimethyl-5-nitroindol-1-ium-1-yl]propane-1-sulfonate |
| SMILES | CC1(C)C(/C=C/Nc2ccccc2)=[N+](CCCS(=O)(=O)[O-])c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C21H23N3O5S/c1-21(2)18-15-17(24(25)26)9-10-19(18)23(13-6-14-30(27,28)29)20(21)11-12-22-16-7-4-3-5-8-16/h3-5,7-12,15H,6,13-14H2,1-2H3,(H,27,28,29) |
| InChIKey | FJYMLUOMCMROCF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|