C21H24ClN3O6 — CID 158107168
N-[(E)-2-(3,3-dimethyl-5-nitro-1-propylindol-1-ium-2-yl)ethenyl]aniline perchlorate (PubChem CID 158107168) has the molecular formula C21H24ClN3O6 and a molecular weight of 449.89 g/mol. Its IUPAC name is N-[(E)-2-(3,3-dimethyl-5-nitro-1-propylindol-1-ium-2-yl)ethenyl]aniline perchlorate.
| Compound Name | N-[(E)-2-(3,3-dimethyl-5-nitro-1-propylindol-1-ium-2-yl)ethenyl]aniline perchlorate |
|---|---|
| PubChem CID | 158107168 |
| Molecular Formula | C21H24ClN3O6 |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N-[(E)-2-(3,3-dimethyl-5-nitro-1-propylindol-1-ium-2-yl)ethenyl]aniline perchlorate |
| SMILES | CCC[N+]1=C(/C=C/Nc2ccccc2)C(C)(C)c2cc([N+](=O)[O-])ccc21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C21H23N3O2.ClHO4/c1-4-14-23-19-11-10-17(24(25)26)15-18(19)21(2,3)20(23)12-13-22-16-8-6-5-7-9-16;2-1(3,4)5/h5-13,15H,4,14H2,1-3H3;(H,2,3,4,5) |
| InChIKey | FPZBUCOAAWYQNR-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 150.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|