C21H19MnN2O5- — CID 58750907
3-[3,3-dimethyl-2-[(E)-2-(5-nitro-2-oxidophenyl)ethenyl]indol-1-ium-1-yl]propanoate;manganese (PubChem CID 58750907) has the molecular formula C21H19MnN2O5- and a molecular weight of 434.33 g/mol. Its IUPAC name is 3-[3,3-dimethyl-2-[(E)-2-(5-nitro-2-oxidophenyl)ethenyl]indol-1-ium-1-yl]propanoate;manganese.
| Compound Name | 3-[3,3-dimethyl-2-[(E)-2-(5-nitro-2-oxidophenyl)ethenyl]indol-1-ium-1-yl]propanoate;manganese |
|---|---|
| PubChem CID | 58750907 |
| Molecular Formula | C21H19MnN2O5- |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 3-[3,3-dimethyl-2-[(E)-2-(5-nitro-2-oxidophenyl)ethenyl]indol-1-ium-1-yl]propanoate;manganese |
| SMILES | CC1(C)C(/C=C/c2cc([N+](=O)[O-])ccc2[O-])=[N+](CCC(=O)[O-])c2ccccc21.[Mn] |
| InChI | InChI=1S/C21H20N2O5.Mn/c1-21(2)16-5-3-4-6-17(16)22(12-11-20(25)26)19(21)10-7-14-13-15(23(27)28)8-9-18(14)24;/h3-10,13H,11-12H2,1-2H3,(H,25,26);/p-1 |
| InChIKey | IWDKZWKCWZQFAH-UHFFFAOYSA-M |
| XLogP | 1.90 |
| TPSA | 109.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|