C29H25N2O3+ — CID 24766796
2-[[3,3-dimethyl-2-(4-phenylphenyl)indol-1-ium-1-yl]methyl]-4-nitrophenol (PubChem CID 24766796) has the molecular formula C29H25N2O3+ and a molecular weight of 449.53 g/mol. Its IUPAC name is 2-[[3,3-dimethyl-2-(4-phenylphenyl)indol-1-ium-1-yl]methyl]-4-nitrophenol.
| Compound Name | 2-[[3,3-dimethyl-2-(4-phenylphenyl)indol-1-ium-1-yl]methyl]-4-nitrophenol |
|---|---|
| PubChem CID | 24766796 |
| Molecular Formula | C29H25N2O3+ |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 2-[[3,3-dimethyl-2-(4-phenylphenyl)indol-1-ium-1-yl]methyl]-4-nitrophenol |
| SMILES | CC1(C)C(c2ccc(-c3ccccc3)cc2)=[N+](Cc2cc([N+](=O)[O-])ccc2O)c2ccccc21 |
| InChI | InChI=1S/C29H24N2O3/c1-29(2)25-10-6-7-11-26(25)30(19-23-18-24(31(33)34)16-17-27(23)32)28(29)22-14-12-21(13-15-22)20-8-4-3-5-9-20/h3-18H,19H2,1-2H3/p+1 |
| InChIKey | YPKUHXKGFKOKFW-UHFFFAOYSA-O |
| XLogP | 6.59 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|