C46H40N3O3+ — CID 137267067
2-[[2-[2-[9,9-dimethyl-7-(N-phenylanilino)fluoren-2-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]methyl]-4-nitrophenol (PubChem CID 137267067) has the molecular formula C46H40N3O3+ and a molecular weight of 682.84 g/mol. Its IUPAC name is 2-[[2-[2-[9,9-dimethyl-7-(N-phenylanilino)fluoren-2-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]methyl]-4-nitrophenol.
| Compound Name | 2-[[2-[2-[9,9-dimethyl-7-(N-phenylanilino)fluoren-2-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]methyl]-4-nitrophenol |
|---|---|
| PubChem CID | 137267067 |
| Molecular Formula | C46H40N3O3+ |
| Molecular Weight | 682.84 g/mol |
| Exact Mass | 682.31 |
| IUPAC Name | 2-[[2-[2-[9,9-dimethyl-7-(N-phenylanilino)fluoren-2-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]methyl]-4-nitrophenol |
| SMILES | CC1(C)C(C=Cc2ccc3c(c2)C(C)(C)c2cc(N(c4ccccc4)c4ccccc4)ccc2-3)=[N+](Cc2cc([N+](=O)[O-])ccc2O)c2ccccc21 |
| InChI | InChI=1S/C46H39N3O3/c1-45(2)40-27-31(19-23-37(40)38-24-21-35(29-41(38)45)48(33-13-7-5-8-14-33)34-15-9-6-10-16-34)20-26-44-46(3,4)39-17-11-12-18-42(39)47(44)30-32-28-36(49(51)52)22-25-43(32)50/h5-29H,30H2,1-4H3/p+1 |
| InChIKey | QBUCGNKHQVVRNV-UHFFFAOYSA-O |
| XLogP | 11.37 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.84 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|