C53H54N2Si2 — CID 58444636
9,9-dimethyl-N-phenyl-N-(4-trimethylsilylphenyl)-7-[(E)-2-[4-(N-(4-trimethylsilylphenyl)anilino)phenyl]ethenyl]fluoren-2-amine (PubChem CID 58444636) has the molecular formula C53H54N2Si2 and a molecular weight of 775.20 g/mol. Its IUPAC name is 9,9-dimethyl-N-phenyl-N-(4-trimethylsilylphenyl)-7-[(E)-2-[4-(N-(4-trimethylsilylphenyl)anilino)phenyl]ethenyl]fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-phenyl-N-(4-trimethylsilylphenyl)-7-[(E)-2-[4-(N-(4-trimethylsilylphenyl)anilino)phenyl]ethenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 58444636 |
| Molecular Formula | C53H54N2Si2 |
| Molecular Weight | 775.20 g/mol |
| Exact Mass | 774.38 |
| IUPAC Name | 9,9-dimethyl-N-phenyl-N-(4-trimethylsilylphenyl)-7-[(E)-2-[4-(N-(4-trimethylsilylphenyl)anilino)phenyl]ethenyl]fluoren-2-amine |
| SMILES | CC1(C)c2cc(/C=C/c3ccc(N(c4ccccc4)c4ccc([Si](C)(C)C)cc4)cc3)ccc2-c2ccc(N(c3ccccc3)c3ccc([Si](C)(C)C)cc3)cc21 |
| InChI | InChI=1S/C53H54N2Si2/c1-53(2)51-37-40(20-19-39-21-24-43(25-22-39)54(41-15-11-9-12-16-41)44-26-31-47(32-27-44)56(3,4)5)23-35-49(51)50-36-30-46(38-52(50)53)55(42-17-13-10-14-18-42)45-28-33-48(34-29-45)57(6,7)8/h9-38H,1-8H3/b20-19+ |
| InChIKey | AKFYQDYVHYWMCH-FMQUCBEESA-N |
| XLogP | 14.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.20 |
| LogP ≤ 5 | 14.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|