C52H50N2Si — CID 58444639
9,9-diethyl-N-phenyl-7-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-N-(4-trimethylsilylphenyl)fluoren-2-amine (PubChem CID 58444639) has the molecular formula C52H50N2Si and a molecular weight of 731.07 g/mol. Its IUPAC name is 9,9-diethyl-N-phenyl-7-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-N-(4-trimethylsilylphenyl)fluoren-2-amine.
| Compound Name | 9,9-diethyl-N-phenyl-7-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-N-(4-trimethylsilylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 58444639 |
| Molecular Formula | C52H50N2Si |
| Molecular Weight | 731.07 g/mol |
| Exact Mass | 730.37 |
| IUPAC Name | 9,9-diethyl-N-phenyl-7-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-N-(4-trimethylsilylphenyl)fluoren-2-amine |
| SMILES | CCC1(CC)c2cc(/C=C/c3ccc(N(c4ccccc4)c4ccccc4)cc3)ccc2-c2ccc(N(c3ccccc3)c3ccc([Si](C)(C)C)cc3)cc21 |
| InChI | InChI=1S/C52H50N2Si/c1-6-52(7-2)50-37-40(24-23-39-25-28-44(29-26-39)53(41-17-11-8-12-18-41)42-19-13-9-14-20-42)27-35-48(50)49-36-32-46(38-51(49)52)54(43-21-15-10-16-22-43)45-30-33-47(34-31-45)55(3,4)5/h8-38H,6-7H2,1-5H3/b24-23+ |
| InChIKey | MUHIPVNGGWGUBR-WCWDXBQESA-N |
| XLogP | 14.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.07 |
| LogP ≤ 5 | 14.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|