C59H53N — CID 89067107
7-[(E)-2-[4-[2-(4-tert-butylphenyl)-4-phenylphenyl]phenyl]ethenyl]-9,9-diethyl-N,N-diphenylfluoren-2-amine (PubChem CID 89067107) has the molecular formula C59H53N and a molecular weight of 776.08 g/mol. Its IUPAC name is 7-[(E)-2-[4-[2-(4-tert-butylphenyl)-4-phenylphenyl]phenyl]ethenyl]-9,9-diethyl-N,N-diphenylfluoren-2-amine.
| Compound Name | 7-[(E)-2-[4-[2-(4-tert-butylphenyl)-4-phenylphenyl]phenyl]ethenyl]-9,9-diethyl-N,N-diphenylfluoren-2-amine |
|---|---|
| PubChem CID | 89067107 |
| Molecular Formula | C59H53N |
| Molecular Weight | 776.08 g/mol |
| Exact Mass | 775.42 |
| IUPAC Name | 7-[(E)-2-[4-[2-(4-tert-butylphenyl)-4-phenylphenyl]phenyl]ethenyl]-9,9-diethyl-N,N-diphenylfluoren-2-amine |
| SMILES | CCC1(CC)c2cc(/C=C/c3ccc(-c4ccc(-c5ccccc5)cc4-c4ccc(C(C)(C)C)cc4)cc3)ccc2-c2ccc(N(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C59H53N/c1-6-59(7-2)56-39-43(27-36-53(56)54-38-35-51(41-57(54)59)60(49-19-13-9-14-20-49)50-21-15-10-16-22-50)24-23-42-25-28-45(29-26-42)52-37-32-47(44-17-11-8-12-18-44)40-55(52)46-30-33-48(34-31-46)58(3,4)5/h8-41H,6-7H2,1-5H3/b24-23+ |
| InChIKey | HKOZXWVSUYWMGM-WCWDXBQESA-N |
| XLogP | 16.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.08 |
| LogP ≤ 5 | 16.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|