C74H72N2 — CID 23561815
2-N,2-N,7-N-tris(9,9-diethylfluoren-2-yl)-9,9-diethyl-7-N-phenylfluorene-2,7-diamine (PubChem CID 23561815) has the molecular formula C74H72N2 and a molecular weight of 989.40 g/mol. Its IUPAC name is 2-N,2-N,7-N-tris(9,9-diethylfluoren-2-yl)-9,9-diethyl-7-N-phenylfluorene-2,7-diamine.
| Compound Name | 2-N,2-N,7-N-tris(9,9-diethylfluoren-2-yl)-9,9-diethyl-7-N-phenylfluorene-2,7-diamine |
|---|---|
| PubChem CID | 23561815 |
| Molecular Formula | C74H72N2 |
| Molecular Weight | 989.40 g/mol |
| Exact Mass | 988.57 |
| IUPAC Name | 2-N,2-N,7-N-tris(9,9-diethylfluoren-2-yl)-9,9-diethyl-7-N-phenylfluorene-2,7-diamine |
| SMILES | CCC1(CC)c2ccccc2-c2ccc(N(c3ccccc3)c3ccc4c(c3)C(CC)(CC)c3cc(N(c5ccc6c(c5)C(CC)(CC)c5ccccc5-6)c5ccc6c(c5)C(CC)(CC)c5ccccc5-6)ccc3-4)cc21 |
| InChI | InChI=1S/C74H72N2/c1-9-71(10-2)63-31-23-20-28-55(63)58-39-34-50(44-66(58)71)75(49-26-18-17-19-27-49)51-35-42-61-62-43-38-54(48-70(62)74(15-7,16-8)69(61)45-51)76(52-36-40-59-56-29-21-24-32-64(56)72(11-3,12-4)67(59)46-52)53-37-41-60-57-30-22-25-33-65(57)73(13-5,14-6)68(60)47-53/h17-48H,9-16H2,1-8H3 |
| InChIKey | FIDDRVDTTIKFIS-UHFFFAOYSA-N |
| XLogP | 20.97 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 989.40 |
| LogP ≤ 5 | 20.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |