C33H35N — CID 20685715
N,N-bis(3,4-dimethylphenyl)-9,9-diethylfluoren-2-amine (PubChem CID 20685715) has the molecular formula C33H35N and a molecular weight of 445.65 g/mol. Its IUPAC name is N,N-bis(3,4-dimethylphenyl)-9,9-diethylfluoren-2-amine.
| Compound Name | N,N-bis(3,4-dimethylphenyl)-9,9-diethylfluoren-2-amine |
|---|---|
| PubChem CID | 20685715 |
| Molecular Formula | C33H35N |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | N,N-bis(3,4-dimethylphenyl)-9,9-diethylfluoren-2-amine |
| SMILES | CCC1(CC)c2ccccc2-c2ccc(N(c3ccc(C)c(C)c3)c3ccc(C)c(C)c3)cc21 |
| InChI | InChI=1S/C33H35N/c1-7-33(8-2)31-12-10-9-11-29(31)30-18-17-28(21-32(30)33)34(26-15-13-22(3)24(5)19-26)27-16-14-23(4)25(6)20-27/h9-21H,7-8H2,1-6H3 |
| InChIKey | JRQBAKGDMBLTKA-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |