[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]boronic acid

C29H28BNO2 — CID 67039823

IUPAC[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]boronic acid
SMILESCCC1(CC)c2cc(B(O)O)ccc2-c2ccc(N(c3ccccc3)c3ccccc3)cc21
InChIInChI=1S/C29H28BNO2/c1-3-29(4-2)27-19-21(30(32)33)15-17-25(27)26-18-16-24(20-28(26)29)31(22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-20,32-33H,3-4H2,1-2H3
InChIKeyCZWRLWYRHUOFEB-UHFFFAOYSA-N
MW433.36 g/mol
LogP5.92
Rot. Bonds6

About [9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]boronic acid

[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]boronic acid (PubChem CID 67039823) has the molecular formula C29H28BNO2 and a molecular weight of 433.36 g/mol. Its IUPAC name is [9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]boronic acid.

Molecular Properties

Compound Name[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]boronic acid
PubChem CID67039823
Molecular FormulaC29H28BNO2
Molecular Weight433.36 g/mol
Exact Mass433.22
IUPAC Name[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]boronic acid
SMILESCCC1(CC)c2cc(B(O)O)ccc2-c2ccc(N(c3ccccc3)c3ccccc3)cc21
InChIInChI=1S/C29H28BNO2/c1-3-29(4-2)27-19-21(30(32)33)15-17-25(27)26-18-16-24(20-28(26)29)31(22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-20,32-33H,3-4H2,1-2H3
InChIKeyCZWRLWYRHUOFEB-UHFFFAOYSA-N
XLogP5.92
TPSA43.70 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms33
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500433.36
LogP ≤ 55.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]boronic acid?
The IUPAC name of [9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]boronic acid (CID 67039823) is [9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]boronic acid.
What is the SMILES notation for [9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]boronic acid?
The canonical SMILES for [9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]boronic acid is CCC1(CC)c2cc(B(O)O)ccc2-c2ccc(N(c3ccccc3)c3ccccc3)cc21.
What is the InChIKey of [9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]boronic acid?
The InChIKey is CZWRLWYRHUOFEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H28BNO2/c1-3-29(4-2)27-19-21(30(32)33)15-17-25(27)26-18-16-24(20-28(26)29)31(22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-20,32-33H,3-4H2,1-2H3.
What are the key properties of [9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]boronic acid?
[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]boronic acid has a molecular weight of 433.36 g/mol, XLogP of 5.92, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]boronic acid is sourced from PubChem (CID 67039823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).