C29H28BNO2 — CID 67039823
[9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]boronic acid (PubChem CID 67039823) has the molecular formula C29H28BNO2 and a molecular weight of 433.36 g/mol. Its IUPAC name is [9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]boronic acid.
| Compound Name | [9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]boronic acid |
|---|---|
| PubChem CID | 67039823 |
| Molecular Formula | C29H28BNO2 |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | [9,9-diethyl-7-(N-phenylanilino)fluoren-2-yl]boronic acid |
| SMILES | CCC1(CC)c2cc(B(O)O)ccc2-c2ccc(N(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C29H28BNO2/c1-3-29(4-2)27-19-21(30(32)33)15-17-25(27)26-18-16-24(20-28(26)29)31(22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-20,32-33H,3-4H2,1-2H3 |
| InChIKey | CZWRLWYRHUOFEB-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|