C41H43N3O4S — CID 58723009
6-[5-(1-benzothiophen-2-yl)-2-[(1E,3E,5E)-5-(1-ethyl-3,3-dimethyl-5-nitroindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]hexanoate (PubChem CID 58723009) has the molecular formula C41H43N3O4S and a molecular weight of 673.88 g/mol. Its IUPAC name is 6-[5-(1-benzothiophen-2-yl)-2-[(1E,3E,5E)-5-(1-ethyl-3,3-dimethyl-5-nitroindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]hexanoate.
| Compound Name | 6-[5-(1-benzothiophen-2-yl)-2-[(1E,3E,5E)-5-(1-ethyl-3,3-dimethyl-5-nitroindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]hexanoate |
|---|---|
| PubChem CID | 58723009 |
| Molecular Formula | C41H43N3O4S |
| Molecular Weight | 673.88 g/mol |
| Exact Mass | 673.30 |
| IUPAC Name | 6-[5-(1-benzothiophen-2-yl)-2-[(1E,3E,5E)-5-(1-ethyl-3,3-dimethyl-5-nitroindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]hexanoate |
| SMILES | CCN1/C(=C/C=C/C=C/C2=[N+](CCCCCC(=O)[O-])c3ccc(-c4cc5ccccc5s4)cc3C2(C)C)C(C)(C)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C41H43N3O4S/c1-6-42-33-23-21-30(44(47)48)27-32(33)41(4,5)37(42)17-9-7-10-18-38-40(2,3)31-25-29(36-26-28-15-12-13-16-35(28)49-36)20-22-34(31)43(38)24-14-8-11-19-39(45)46/h7,9-10,12-13,15-18,20-23,25-27H,6,8,11,14,19,24H2,1-5H3 |
| InChIKey | IKUSBWBAJDAWTE-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.88 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|