C30H38N3O3+ — CID 72606771
1-butyl-2-[3-(1-ethyl-5-methoxy-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethyl-5-nitroindol-1-ium (PubChem CID 72606771) has the molecular formula C30H38N3O3+ and a molecular weight of 488.65 g/mol. Its IUPAC name is 1-butyl-2-[3-(1-ethyl-5-methoxy-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethyl-5-nitroindol-1-ium.
| Compound Name | 1-butyl-2-[3-(1-ethyl-5-methoxy-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethyl-5-nitroindol-1-ium |
|---|---|
| PubChem CID | 72606771 |
| Molecular Formula | C30H38N3O3+ |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 1-butyl-2-[3-(1-ethyl-5-methoxy-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethyl-5-nitroindol-1-ium |
| SMILES | CCCC[N+]1=C(C=CC=C2N(CC)c3ccc(OC)cc3C2(C)C)C(C)(C)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C30H38N3O3/c1-8-10-18-32-26-16-14-21(33(34)35)19-23(26)29(3,4)28(32)13-11-12-27-30(5,6)24-20-22(36-7)15-17-25(24)31(27)9-2/h11-17,19-20H,8-10,18H2,1-7H3/q+1 |
| InChIKey | VRIZIVOJGCLQHJ-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|