C27H31Cl2IN2 — CID 118731721
(2E)-5-chloro-2-[(E)-3-(5-chloro-1-ethyl-3,3-dimethylindol-1-ium-2-yl)prop-2-enylidene]-1-ethyl-3,3-dimethylindole iodide (PubChem CID 118731721) has the molecular formula C27H31Cl2IN2 and a molecular weight of 581.37 g/mol. Its IUPAC name is (2E)-5-chloro-2-[(E)-3-(5-chloro-1-ethyl-3,3-dimethylindol-1-ium-2-yl)prop-2-enylidene]-1-ethyl-3,3-dimethylindole iodide.
| Compound Name | (2E)-5-chloro-2-[(E)-3-(5-chloro-1-ethyl-3,3-dimethylindol-1-ium-2-yl)prop-2-enylidene]-1-ethyl-3,3-dimethylindole iodide |
|---|---|
| PubChem CID | 118731721 |
| Molecular Formula | C27H31Cl2IN2 |
| Molecular Weight | 581.37 g/mol |
| Exact Mass | 580.09 |
| IUPAC Name | (2E)-5-chloro-2-[(E)-3-(5-chloro-1-ethyl-3,3-dimethylindol-1-ium-2-yl)prop-2-enylidene]-1-ethyl-3,3-dimethylindole iodide |
| SMILES | CCN1/C(=C/C=C/C2=[N+](CC)c3ccc(Cl)cc3C2(C)C)C(C)(C)c2cc(Cl)ccc21.[I-] |
| InChI | InChI=1S/C27H31Cl2N2.HI/c1-7-30-22-14-12-18(28)16-20(22)26(3,4)24(30)10-9-11-25-27(5,6)21-17-19(29)13-15-23(21)31(25)8-2;/h9-17H,7-8H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | ORQPTJQTYRIITD-UHFFFAOYSA-M |
| XLogP | 4.65 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|