C27H33N2O2+ — CID 73299972
1-ethyl-2-[3-(1-ethyl-5-hydroxy-3,3-dimethylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindol-5-ol (PubChem CID 73299972) has the molecular formula C27H33N2O2+ and a molecular weight of 417.57 g/mol. Its IUPAC name is 1-ethyl-2-[3-(1-ethyl-5-hydroxy-3,3-dimethylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindol-5-ol.
| Compound Name | 1-ethyl-2-[3-(1-ethyl-5-hydroxy-3,3-dimethylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindol-5-ol |
|---|---|
| PubChem CID | 73299972 |
| Molecular Formula | C27H33N2O2+ |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 1-ethyl-2-[3-(1-ethyl-5-hydroxy-3,3-dimethylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindol-5-ol |
| SMILES | CCN1C(=CC=CC2=[N+](CC)c3ccc(O)cc3C2(C)C)C(C)(C)c2cc(O)ccc21 |
| InChI | InChI=1S/C27H32N2O2/c1-7-28-22-14-12-18(30)16-20(22)26(3,4)24(28)10-9-11-25-27(5,6)21-17-19(31)13-15-23(21)29(25)8-2/h9-17H,7-8H2,1-6H3,(H-,30,31)/p+1 |
| InChIKey | UIHAFBSHAOOIHM-UHFFFAOYSA-O |
| XLogP | 5.75 |
| TPSA | 46.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|