C34H45N2O6S2+ — CID 173381676
2-[5-[3,3-dimethyl-1-(5-methylhexyl)-5-sulfoindol-1-ium-2-yl]penta-2,4-dienylidene]-1-ethyl-3,3-dimethylindole-5-sulfonic acid (PubChem CID 173381676) has the molecular formula C34H45N2O6S2+ and a molecular weight of 641.88 g/mol. Its IUPAC name is 2-[5-[3,3-dimethyl-1-(5-methylhexyl)-5-sulfoindol-1-ium-2-yl]penta-2,4-dienylidene]-1-ethyl-3,3-dimethylindole-5-sulfonic acid.
| Compound Name | 2-[5-[3,3-dimethyl-1-(5-methylhexyl)-5-sulfoindol-1-ium-2-yl]penta-2,4-dienylidene]-1-ethyl-3,3-dimethylindole-5-sulfonic acid |
|---|---|
| PubChem CID | 173381676 |
| Molecular Formula | C34H45N2O6S2+ |
| Molecular Weight | 641.88 g/mol |
| Exact Mass | 641.27 |
| IUPAC Name | 2-[5-[3,3-dimethyl-1-(5-methylhexyl)-5-sulfoindol-1-ium-2-yl]penta-2,4-dienylidene]-1-ethyl-3,3-dimethylindole-5-sulfonic acid |
| SMILES | CCN1C(=CC=CC=CC2=[N+](CCCCC(C)C)c3ccc(S(=O)(=O)O)cc3C2(C)C)C(C)(C)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C34H44N2O6S2/c1-8-35-29-19-17-25(43(37,38)39)22-27(29)33(4,5)31(35)15-10-9-11-16-32-34(6,7)28-23-26(44(40,41)42)18-20-30(28)36(32)21-13-12-14-24(2)3/h9-11,15-20,22-24H,8,12-14,21H2,1-7H3,(H-,37,38,39,40,41,42)/p+1 |
| InChIKey | SHQGMSINWDJQMY-UHFFFAOYSA-O |
| XLogP | 7.20 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.88 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|