C37H49N2O10S3+ — CID 170645685
(2E)-2-[(2E,4E)-5-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-1-(7-methyl-6-oxooctyl)indole-5-sulfonic acid (PubChem CID 170645685) has the molecular formula C37H49N2O10S3+ and a molecular weight of 778.00 g/mol. Its IUPAC name is (2E)-2-[(2E,4E)-5-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-1-(7-methyl-6-oxooctyl)indole-5-sulfonic acid.
| Compound Name | (2E)-2-[(2E,4E)-5-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-1-(7-methyl-6-oxooctyl)indole-5-sulfonic acid |
|---|---|
| PubChem CID | 170645685 |
| Molecular Formula | C37H49N2O10S3+ |
| Molecular Weight | 778.00 g/mol |
| Exact Mass | 777.25 |
| IUPAC Name | (2E)-2-[(2E,4E)-5-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-1-(7-methyl-6-oxooctyl)indole-5-sulfonic acid |
| SMILES | CC(C)C(=O)CCCCCN1/C(=C/C=C/C=C/C2=[N+](CCCS(=O)(=O)O)c3ccc(S(=O)(=O)O)cc3C2(C)C)C(C)(C)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C37H48N2O10S3/c1-26(2)33(40)14-9-8-12-21-38-31-19-17-27(51(44,45)46)24-29(31)36(3,4)34(38)15-10-7-11-16-35-37(5,6)30-25-28(52(47,48)49)18-20-32(30)39(35)22-13-23-50(41,42)43/h7,10-11,15-20,24-26H,8-9,12-14,21-23H2,1-6H3,(H2-,41,42,43,44,45,46,47,48,49)/p+1 |
| InChIKey | LWMWOIGRQROPMG-UHFFFAOYSA-O |
| XLogP | 6.41 |
| TPSA | 186.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.00 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|