C38H49N2O14S4+ — CID 73223990
6-[2-[7-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3-methyl-5-sulfo-1-(3-sulfopropyl)indol-3-yl]hexanoic acid (PubChem CID 73223990) has the molecular formula C38H49N2O14S4+ and a molecular weight of 886.08 g/mol. Its IUPAC name is 6-[2-[7-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3-methyl-5-sulfo-1-(3-sulfopropyl)indol-3-yl]hexanoic acid.
| Compound Name | 6-[2-[7-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3-methyl-5-sulfo-1-(3-sulfopropyl)indol-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 73223990 |
| Molecular Formula | C38H49N2O14S4+ |
| Molecular Weight | 886.08 g/mol |
| Exact Mass | 885.21 |
| IUPAC Name | 6-[2-[7-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3-methyl-5-sulfo-1-(3-sulfopropyl)indol-3-yl]hexanoic acid |
| SMILES | CC1(C)C(C=CC=CC=CC=C2N(CCCS(=O)(=O)O)c3ccc(S(=O)(=O)O)cc3C2(C)CCCCCC(=O)O)=[N+](CCCS(=O)(=O)O)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C38H48N2O14S4/c1-37(2)30-26-28(57(49,50)51)17-19-32(30)39(22-12-24-55(43,44)45)34(37)14-8-5-4-6-9-15-35-38(3,21-11-7-10-16-36(41)42)31-27-29(58(52,53)54)18-20-33(31)40(35)23-13-25-56(46,47)48/h4-6,8-9,14-15,17-20,26-27H,7,10-13,16,21-25H2,1-3H3,(H4-,41,42,43,44,45,46,47,48,49,50,51,52,53,54)/p+1 |
| InChIKey | SVRFTZMFOMUHLE-UHFFFAOYSA-O |
| XLogP | 5.48 |
| TPSA | 261.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.08 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|