C44H59N2O12S2+ — CID 72579175
6-[2-[5-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfoindol-1-ium-2-yl]penta-2,4-dienylidene]-1-(6-ethoxy-6-oxohexyl)-3-methyl-5-sulfoindol-3-yl]hexanoic acid (PubChem CID 72579175) has the molecular formula C44H59N2O12S2+ and a molecular weight of 872.09 g/mol. Its IUPAC name is 6-[2-[5-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfoindol-1-ium-2-yl]penta-2,4-dienylidene]-1-(6-ethoxy-6-oxohexyl)-3-methyl-5-sulfoindol-3-yl]hexanoic acid.
| Compound Name | 6-[2-[5-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfoindol-1-ium-2-yl]penta-2,4-dienylidene]-1-(6-ethoxy-6-oxohexyl)-3-methyl-5-sulfoindol-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 72579175 |
| Molecular Formula | C44H59N2O12S2+ |
| Molecular Weight | 872.09 g/mol |
| Exact Mass | 871.35 |
| IUPAC Name | 6-[2-[5-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfoindol-1-ium-2-yl]penta-2,4-dienylidene]-1-(6-ethoxy-6-oxohexyl)-3-methyl-5-sulfoindol-3-yl]hexanoic acid |
| SMILES | CCOC(=O)CCCCCN1C(=CC=CC=CC2=[N+](CCCCCC(=O)O)c3ccc(S(=O)(=O)O)cc3C2(C)C)C(C)(CCCCCC(=O)O)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C44H58N2O12S2/c1-5-58-42(51)22-14-9-17-29-46-37-26-24-33(60(55,56)57)31-35(37)44(4,27-15-7-12-20-40(47)48)39(46)19-11-6-10-18-38-43(2,3)34-30-32(59(52,53)54)23-25-36(34)45(38)28-16-8-13-21-41(49)50/h6,10-11,18-19,23-26,30-31H,5,7-9,12-17,20-22,27-29H2,1-4H3,(H3-,47,48,49,50,52,53,54,55,56,57)/p+1 |
| InChIKey | WFEWYPVMZBWCSN-UHFFFAOYSA-O |
| XLogP | 8.13 |
| TPSA | 215.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.09 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|