C38H45N2O8S3+ — CID 88564113
6-[2-[(1E,3E,5E)-5-[1-ethyl-3-methyl-5-sulfo-3-(2-thiophen-2-ylethyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoic acid (PubChem CID 88564113) has the molecular formula C38H45N2O8S3+ and a molecular weight of 753.99 g/mol. Its IUPAC name is 6-[2-[(1E,3E,5E)-5-[1-ethyl-3-methyl-5-sulfo-3-(2-thiophen-2-ylethyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[2-[(1E,3E,5E)-5-[1-ethyl-3-methyl-5-sulfo-3-(2-thiophen-2-ylethyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 88564113 |
| Molecular Formula | C38H45N2O8S3+ |
| Molecular Weight | 753.99 g/mol |
| Exact Mass | 753.23 |
| IUPAC Name | 6-[2-[(1E,3E,5E)-5-[1-ethyl-3-methyl-5-sulfo-3-(2-thiophen-2-ylethyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoic acid |
| SMILES | CCN1/C(=C/C=C/C=C/C2=[N+](CCCCCC(=O)O)c3ccc(S(=O)(=O)O)cc3C2(C)C)C(C)(CCc2cccs2)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C38H44N2O8S3/c1-5-39-33-20-18-29(51(46,47)48)26-31(33)38(4,22-21-27-13-12-24-49-27)35(39)15-9-6-8-14-34-37(2,3)30-25-28(50(43,44)45)17-19-32(30)40(34)23-11-7-10-16-36(41)42/h6,8-9,12-15,17-20,24-26H,5,7,10-11,16,21-23H2,1-4H3,(H2-,41,42,43,44,45,46,47,48)/p+1 |
| InChIKey | OMRQZDJSMUBONP-UHFFFAOYSA-O |
| XLogP | 7.69 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.99 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|