C37H49N2O10S2+ — CID 76652540
6-[2-[3-[3-(5-carboxypentyl)-1-ethyl-3-methyl-5-sulfoindol-2-ylidene]prop-1-enyl]-1-ethyl-3-methyl-5-sulfoindol-1-ium-3-yl]hexanoic acid (PubChem CID 76652540) has the molecular formula C37H49N2O10S2+ and a molecular weight of 745.94 g/mol. Its IUPAC name is 6-[2-[3-[3-(5-carboxypentyl)-1-ethyl-3-methyl-5-sulfoindol-2-ylidene]prop-1-enyl]-1-ethyl-3-methyl-5-sulfoindol-1-ium-3-yl]hexanoic acid.
| Compound Name | 6-[2-[3-[3-(5-carboxypentyl)-1-ethyl-3-methyl-5-sulfoindol-2-ylidene]prop-1-enyl]-1-ethyl-3-methyl-5-sulfoindol-1-ium-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 76652540 |
| Molecular Formula | C37H49N2O10S2+ |
| Molecular Weight | 745.94 g/mol |
| Exact Mass | 745.28 |
| IUPAC Name | 6-[2-[3-[3-(5-carboxypentyl)-1-ethyl-3-methyl-5-sulfoindol-2-ylidene]prop-1-enyl]-1-ethyl-3-methyl-5-sulfoindol-1-ium-3-yl]hexanoic acid |
| SMILES | CCN1C(=CC=CC2=[N+](CC)c3ccc(S(=O)(=O)O)cc3C2(C)CCCCCC(=O)O)C(C)(CCCCCC(=O)O)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C37H48N2O10S2/c1-5-38-30-20-18-26(50(44,45)46)24-28(30)36(3,22-11-7-9-16-34(40)41)32(38)14-13-15-33-37(4,23-12-8-10-17-35(42)43)29-25-27(51(47,48)49)19-21-31(29)39(33)6-2/h13-15,18-21,24-25H,5-12,16-17,22-23H2,1-4H3,(H3-,40,41,42,43,44,45,46,47,48,49)/p+1 |
| InChIKey | JQYOOYIOUMCMCT-UHFFFAOYSA-O |
| XLogP | 6.86 |
| TPSA | 189.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.94 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|