C39H51N2O12S3+ — CID 123313211
6-[2-[7-[1-ethyl-3-methyl-5-sulfo-3-(3-sulfopropyl)indol-2-ylidene]hepta-1,3,5-trienyl]-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-1-ium-1-yl]hexanoic acid (PubChem CID 123313211) has the molecular formula C39H51N2O12S3+ and a molecular weight of 836.04 g/mol. Its IUPAC name is 6-[2-[7-[1-ethyl-3-methyl-5-sulfo-3-(3-sulfopropyl)indol-2-ylidene]hepta-1,3,5-trienyl]-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[2-[7-[1-ethyl-3-methyl-5-sulfo-3-(3-sulfopropyl)indol-2-ylidene]hepta-1,3,5-trienyl]-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 123313211 |
| Molecular Formula | C39H51N2O12S3+ |
| Molecular Weight | 836.04 g/mol |
| Exact Mass | 835.26 |
| IUPAC Name | 6-[2-[7-[1-ethyl-3-methyl-5-sulfo-3-(3-sulfopropyl)indol-2-ylidene]hepta-1,3,5-trienyl]-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-1-ium-1-yl]hexanoic acid |
| SMILES | CCN1C(=CC=CC=CC=CC2=[N+](CCCCCC(=O)O)c3ccc(S(=O)(=O)O)cc3C2(C)CCOC)C(C)(CCCS(=O)(=O)O)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C39H50N2O12S3/c1-5-40-33-20-18-29(55(47,48)49)27-31(33)38(2,22-14-26-54(44,45)46)35(40)15-10-7-6-8-11-16-36-39(3,23-25-53-4)32-28-30(56(50,51)52)19-21-34(32)41(36)24-13-9-12-17-37(42)43/h6-8,10-11,15-16,18-21,27-28H,5,9,12-14,17,22-26H2,1-4H3,(H3-,42,43,44,45,46,47,48,49,50,51,52)/p+1 |
| InChIKey | PEYJMHQHJHMXPW-UHFFFAOYSA-O |
| XLogP | 6.24 |
| TPSA | 215.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.04 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|