C37H49N2O10S2+ — CID 90386416
6-[2-[(1E,3E,5E)-5-[1-ethyl-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-2-ylidene]penta-1,3-dienyl]-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-1-ium-1-yl]hexanoic acid (PubChem CID 90386416) has the molecular formula C37H49N2O10S2+ and a molecular weight of 745.94 g/mol. Its IUPAC name is 6-[2-[(1E,3E,5E)-5-[1-ethyl-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-2-ylidene]penta-1,3-dienyl]-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[2-[(1E,3E,5E)-5-[1-ethyl-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-2-ylidene]penta-1,3-dienyl]-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 90386416 |
| Molecular Formula | C37H49N2O10S2+ |
| Molecular Weight | 745.94 g/mol |
| Exact Mass | 745.28 |
| IUPAC Name | 6-[2-[(1E,3E,5E)-5-[1-ethyl-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-2-ylidene]penta-1,3-dienyl]-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-1-ium-1-yl]hexanoic acid |
| SMILES | CCN1/C(=C/C=C/C=C/C2=[N+](CCCCCC(=O)O)c3ccc(S(=O)(=O)O)cc3C2(C)CCOC)C(C)(CCOC)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C37H48N2O10S2/c1-6-38-31-18-16-27(50(42,43)44)25-29(31)36(2,20-23-48-4)33(38)13-9-7-10-14-34-37(3,21-24-49-5)30-26-28(51(45,46)47)17-19-32(30)39(34)22-12-8-11-15-35(40)41/h7,9-10,13-14,16-19,25-26H,6,8,11-12,15,20-24H2,1-5H3,(H2-,40,41,42,43,44,45,46,47)/p+1 |
| InChIKey | IHGPVBDJHORUDV-UHFFFAOYSA-O |
| XLogP | 6.05 |
| TPSA | 170.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.94 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|