C35H47N2O11S3+ — CID 161197570
6-[2-[3-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,5-dimethyl-1-propylindol-3-yl]hexanoic acid;sulfur trioxide (PubChem CID 161197570) has the molecular formula C35H47N2O11S3+ and a molecular weight of 767.96 g/mol. Its IUPAC name is 6-[2-[3-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,5-dimethyl-1-propylindol-3-yl]hexanoic acid;sulfur trioxide.
| Compound Name | 6-[2-[3-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,5-dimethyl-1-propylindol-3-yl]hexanoic acid;sulfur trioxide |
|---|---|
| PubChem CID | 161197570 |
| Molecular Formula | C35H47N2O11S3+ |
| Molecular Weight | 767.96 g/mol |
| Exact Mass | 767.23 |
| IUPAC Name | 6-[2-[3-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,5-dimethyl-1-propylindol-3-yl]hexanoic acid;sulfur trioxide |
| SMILES | CCCN1C(=CC=CC2=[N+](CCCS(=O)(=O)O)c3ccc(S(=O)(=O)O)cc3C2(C)C)C(C)(CCCCCC(=O)O)c2cc(C)ccc21.O=S(=O)=O |
| InChI | InChI=1S/C35H46N2O8S2.O3S/c1-6-20-36-30-17-15-25(2)23-28(30)35(5,19-9-7-8-14-33(38)39)32(36)13-10-12-31-34(3,4)27-24-26(47(43,44)45)16-18-29(27)37(31)21-11-22-46(40,41)42;1-4(2)3/h10,12-13,15-18,23-24H,6-9,11,14,19-22H2,1-5H3,(H2-,38,39,40,41,42,43,44,45);/p+1 |
| InChIKey | UUNYNWQZJMFJSO-UHFFFAOYSA-O |
| XLogP | 5.55 |
| TPSA | 203.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.96 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|