C36H47N2O5S+ — CID 25122697
5-[(2E)-2-[(2E,4E)-5-(1-ethyl-3,3-dimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-3,5-dimethyl-1-(4-sulfobutyl)indol-3-yl]pentanoic acid (PubChem CID 25122697) has the molecular formula C36H47N2O5S+ and a molecular weight of 619.85 g/mol. Its IUPAC name is 5-[(2E)-2-[(2E,4E)-5-(1-ethyl-3,3-dimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-3,5-dimethyl-1-(4-sulfobutyl)indol-3-yl]pentanoic acid.
| Compound Name | 5-[(2E)-2-[(2E,4E)-5-(1-ethyl-3,3-dimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-3,5-dimethyl-1-(4-sulfobutyl)indol-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 25122697 |
| Molecular Formula | C36H47N2O5S+ |
| Molecular Weight | 619.85 g/mol |
| Exact Mass | 619.32 |
| IUPAC Name | 5-[(2E)-2-[(2E,4E)-5-(1-ethyl-3,3-dimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-3,5-dimethyl-1-(4-sulfobutyl)indol-3-yl]pentanoic acid |
| SMILES | CC[N+]1=C(/C=C/C=C/C=C2/N(CCCCS(=O)(=O)O)c3ccc(C)cc3C2(C)CCCCC(=O)O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C36H46N2O5S/c1-6-37-30-17-11-10-16-28(30)35(3,4)32(37)18-8-7-9-19-33-36(5,23-13-12-20-34(39)40)29-26-27(2)21-22-31(29)38(33)24-14-15-25-44(41,42)43/h7-11,16-19,21-22,26H,6,12-15,20,23-25H2,1-5H3,(H-,39,40,41,42,43)/p+1 |
| InChIKey | YHTXAKDIEDYHAM-UHFFFAOYSA-O |
| XLogP | 7.48 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.85 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|