C40H55N2O8S2+ — CID 25121255
5-[(2E)-3,6-dimethyl-1-(4-sulfobutyl)-2-[(2E,4E)-5-[3,3,5,7-tetramethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]penta-2,4-dienylidene]indol-3-yl]pentanoic acid (PubChem CID 25121255) has the molecular formula C40H55N2O8S2+ and a molecular weight of 756.02 g/mol. Its IUPAC name is 5-[(2E)-3,6-dimethyl-1-(4-sulfobutyl)-2-[(2E,4E)-5-[3,3,5,7-tetramethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]penta-2,4-dienylidene]indol-3-yl]pentanoic acid.
| Compound Name | 5-[(2E)-3,6-dimethyl-1-(4-sulfobutyl)-2-[(2E,4E)-5-[3,3,5,7-tetramethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]penta-2,4-dienylidene]indol-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 25121255 |
| Molecular Formula | C40H55N2O8S2+ |
| Molecular Weight | 756.02 g/mol |
| Exact Mass | 755.34 |
| IUPAC Name | 5-[(2E)-3,6-dimethyl-1-(4-sulfobutyl)-2-[(2E,4E)-5-[3,3,5,7-tetramethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]penta-2,4-dienylidene]indol-3-yl]pentanoic acid |
| SMILES | Cc1ccc2c(c1)N(CCCCS(=O)(=O)O)/C(=C/C=C/C=C/C1=[N+](CCCCS(=O)(=O)O)c3c(C)cc(C)cc3C1(C)C)C2(C)CCCCC(=O)O |
| InChI | InChI=1S/C40H54N2O8S2/c1-29-19-20-32-34(28-29)41(22-12-14-24-51(45,46)47)36(40(32,6)21-11-10-18-37(43)44)17-9-7-8-16-35-39(4,5)33-27-30(2)26-31(3)38(33)42(35)23-13-15-25-52(48,49)50/h7-9,16-17,19-20,26-28H,10-15,18,21-25H2,1-6H3,(H2-,43,44,45,46,47,48,49,50)/p+1 |
| InChIKey | QDTNBXZQBRASRS-UHFFFAOYSA-O |
| XLogP | 7.74 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.02 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|