C41H53N2O10S2+ — CID 54055848
4-[2-[7-[3-(3-carboxypropyl)-3-methyl-1-(4-sulfobutyl)indol-2-ylidene]hepta-1,3,5-trienyl]-3-methyl-1-(4-sulfobutyl)indol-1-ium-3-yl]butanoic acid (PubChem CID 54055848) has the molecular formula C41H53N2O10S2+ and a molecular weight of 798.01 g/mol. Its IUPAC name is 4-[2-[7-[3-(3-carboxypropyl)-3-methyl-1-(4-sulfobutyl)indol-2-ylidene]hepta-1,3,5-trienyl]-3-methyl-1-(4-sulfobutyl)indol-1-ium-3-yl]butanoic acid.
| Compound Name | 4-[2-[7-[3-(3-carboxypropyl)-3-methyl-1-(4-sulfobutyl)indol-2-ylidene]hepta-1,3,5-trienyl]-3-methyl-1-(4-sulfobutyl)indol-1-ium-3-yl]butanoic acid |
|---|---|
| PubChem CID | 54055848 |
| Molecular Formula | C41H53N2O10S2+ |
| Molecular Weight | 798.01 g/mol |
| Exact Mass | 797.31 |
| IUPAC Name | 4-[2-[7-[3-(3-carboxypropyl)-3-methyl-1-(4-sulfobutyl)indol-2-ylidene]hepta-1,3,5-trienyl]-3-methyl-1-(4-sulfobutyl)indol-1-ium-3-yl]butanoic acid |
| SMILES | CC1(CCCC(=O)O)C(=CC=CC=CC=CC2=[N+](CCCCS(=O)(=O)O)c3ccccc3C2(C)CCCC(=O)O)N(CCCCS(=O)(=O)O)c2ccccc21 |
| InChI | InChI=1S/C41H52N2O10S2/c1-40(26-16-24-38(44)45)32-18-8-10-20-34(32)42(28-12-14-30-54(48,49)50)36(40)22-6-4-3-5-7-23-37-41(2,27-17-25-39(46)47)33-19-9-11-21-35(33)43(37)29-13-15-31-55(51,52)53/h3-11,18-23H,12-17,24-31H2,1-2H3,(H3-,44,45,46,47,48,49,50,51,52,53)/p+1 |
| InChIKey | LWERNWVFSUZXQJ-UHFFFAOYSA-O |
| XLogP | 7.22 |
| TPSA | 189.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.01 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|