C41H52N2O10S2 — CID 172762435
4-[3-(3-carboxypropyl)-2-[7-[3-(3-carboxypropyl)-3-methyl-1-(4-sulfobutyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3-methylindol-1-yl]butane-1-sulfonate (PubChem CID 172762435) has the molecular formula C41H52N2O10S2 and a molecular weight of 797.00 g/mol. Its IUPAC name is 4-[3-(3-carboxypropyl)-2-[7-[3-(3-carboxypropyl)-3-methyl-1-(4-sulfobutyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3-methylindol-1-yl]butane-1-sulfonate.
| Compound Name | 4-[3-(3-carboxypropyl)-2-[7-[3-(3-carboxypropyl)-3-methyl-1-(4-sulfobutyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3-methylindol-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 172762435 |
| Molecular Formula | C41H52N2O10S2 |
| Molecular Weight | 797.00 g/mol |
| Exact Mass | 796.31 |
| IUPAC Name | 4-[3-(3-carboxypropyl)-2-[7-[3-(3-carboxypropyl)-3-methyl-1-(4-sulfobutyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3-methylindol-1-yl]butane-1-sulfonate |
| SMILES | CC1(CCCC(=O)O)C(=CC=CC=CC=CC2=[N+](CCCCS(=O)(=O)O)c3ccccc3C2(C)CCCC(=O)O)N(CCCCS(=O)(=O)[O-])c2ccccc21 |
| InChI | InChI=1S/C41H52N2O10S2/c1-40(26-16-24-38(44)45)32-18-8-10-20-34(32)42(28-12-14-30-54(48,49)50)36(40)22-6-4-3-5-7-23-37-41(2,27-17-25-39(46)47)33-19-9-11-21-35(33)43(37)29-13-15-31-55(51,52)53/h3-11,18-23H,12-17,24-31H2,1-2H3,(H3-,44,45,46,47,48,49,50,51,52,53) |
| InChIKey | LWERNWVFSUZXQJ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 192.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.00 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|