C38H50N2O8S2 — CID 160870460
2-[5-[1-butyl-3-(5-carboxypentyl)-3,5-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonate (PubChem CID 160870460) has the molecular formula C38H50N2O8S2 and a molecular weight of 726.96 g/mol. Its IUPAC name is 2-[5-[1-butyl-3-(5-carboxypentyl)-3,5-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonate.
| Compound Name | 2-[5-[1-butyl-3-(5-carboxypentyl)-3,5-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonate |
|---|---|
| PubChem CID | 160870460 |
| Molecular Formula | C38H50N2O8S2 |
| Molecular Weight | 726.96 g/mol |
| Exact Mass | 726.30 |
| IUPAC Name | 2-[5-[1-butyl-3-(5-carboxypentyl)-3,5-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonate |
| SMILES | CCCCN1C(=CC=CC=CC2=[N+](CCCS(=O)(=O)O)c3ccc(S(=O)(=O)[O-])cc3C2(C)C)C(C)(CCCCCC(=O)O)c2cc(C)ccc21 |
| InChI | InChI=1S/C38H50N2O8S2/c1-6-7-23-40-33-20-18-28(2)26-31(33)38(5,22-13-9-12-17-36(41)42)35(40)16-11-8-10-15-34-37(3,4)30-27-29(50(46,47)48)19-21-32(30)39(34)24-14-25-49(43,44)45/h8,10-11,15-16,18-21,26-27H,6-7,9,12-14,17,22-25H2,1-5H3,(H2-,41,42,43,44,45,46,47,48) |
| InChIKey | SLRLSDSYNVNOHS-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 155.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.96 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|