C31H35KN2O6S2 — CID 72779063
potassium 1-ethyl-2-[3-(1-hex-5-ynyl-3,3-dimethyl-5-sulfonatoindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindole-5-sulfonate (PubChem CID 72779063) has the molecular formula C31H35KN2O6S2 and a molecular weight of 634.86 g/mol. Its IUPAC name is potassium 1-ethyl-2-[3-(1-hex-5-ynyl-3,3-dimethyl-5-sulfonatoindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindole-5-sulfonate.
| Compound Name | potassium 1-ethyl-2-[3-(1-hex-5-ynyl-3,3-dimethyl-5-sulfonatoindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindole-5-sulfonate |
|---|---|
| PubChem CID | 72779063 |
| Molecular Formula | C31H35KN2O6S2 |
| Molecular Weight | 634.86 g/mol |
| Exact Mass | 634.16 |
| IUPAC Name | potassium 1-ethyl-2-[3-(1-hex-5-ynyl-3,3-dimethyl-5-sulfonatoindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindole-5-sulfonate |
| SMILES | C#CCCCC[N+]1=C(C=CC=C2N(CC)c3ccc(S(=O)(=O)[O-])cc3C2(C)C)C(C)(C)c2cc(S(=O)(=O)[O-])ccc21.[K+] |
| InChI | InChI=1S/C31H36N2O6S2.K/c1-7-9-10-11-19-33-27-18-16-23(41(37,38)39)21-25(27)31(5,6)29(33)14-12-13-28-30(3,4)24-20-22(40(34,35)36)15-17-26(24)32(28)8-2;/h1,12-18,20-21H,8-11,19H2,2-6H3,(H-,34,35,36,37,38,39);/q;+1/p-1 |
| InChIKey | AWFZKOAGVYBNAO-UHFFFAOYSA-M |
| XLogP | 1.94 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.86 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|