C41H43Cl2N2+ — CID 118731725
(2E)-5-chloro-2-[(E)-3-[5-chloro-3,3-dimethyl-1-(3-phenylpropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-phenylpropyl)indole (PubChem CID 118731725) has the molecular formula C41H43Cl2N2+ and a molecular weight of 634.72 g/mol. Its IUPAC name is (2E)-5-chloro-2-[(E)-3-[5-chloro-3,3-dimethyl-1-(3-phenylpropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-phenylpropyl)indole.
| Compound Name | (2E)-5-chloro-2-[(E)-3-[5-chloro-3,3-dimethyl-1-(3-phenylpropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-phenylpropyl)indole |
|---|---|
| PubChem CID | 118731725 |
| Molecular Formula | C41H43Cl2N2+ |
| Molecular Weight | 634.72 g/mol |
| Exact Mass | 633.28 |
| IUPAC Name | (2E)-5-chloro-2-[(E)-3-[5-chloro-3,3-dimethyl-1-(3-phenylpropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-phenylpropyl)indole |
| SMILES | CC1(C)C(/C=C/C=C2/N(CCCc3ccccc3)c3ccc(Cl)cc3C2(C)C)=[N+](CCCc2ccccc2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C41H43Cl2N2/c1-40(2)34-28-32(42)22-24-36(34)44(26-12-18-30-14-7-5-8-15-30)38(40)20-11-21-39-41(3,4)35-29-33(43)23-25-37(35)45(39)27-13-19-31-16-9-6-10-17-31/h5-11,14-17,20-25,28-29H,12-13,18-19,26-27H2,1-4H3/q+1 |
| InChIKey | SNASIPHDQMTNOG-UHFFFAOYSA-N |
| XLogP | 10.87 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.72 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|