C33H44Cl2N3O6S2+ — CID 58700655
4-[5-chloro-2-[3-[5-chloro-1-[4-(ethylaminooxysulfonyl)butyl]-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonic acid (PubChem CID 58700655) has the molecular formula C33H44Cl2N3O6S2+ and a molecular weight of 713.77 g/mol. Its IUPAC name is 4-[5-chloro-2-[3-[5-chloro-1-[4-(ethylaminooxysulfonyl)butyl]-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[5-chloro-2-[3-[5-chloro-1-[4-(ethylaminooxysulfonyl)butyl]-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 58700655 |
| Molecular Formula | C33H44Cl2N3O6S2+ |
| Molecular Weight | 713.77 g/mol |
| Exact Mass | 712.20 |
| IUPAC Name | 4-[5-chloro-2-[3-[5-chloro-1-[4-(ethylaminooxysulfonyl)butyl]-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonic acid |
| SMILES | CCNOS(=O)(=O)CCCC[N+]1=C(C=CC=C2N(CCCCS(=O)(=O)O)c3ccc(Cl)cc3C2(C)C)C(C)(C)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C33H43Cl2N3O6S2/c1-6-36-44-46(42,43)21-10-8-19-38-29-17-15-25(35)23-27(29)33(4,5)31(38)13-11-12-30-32(2,3)26-22-24(34)14-16-28(26)37(30)18-7-9-20-45(39,40)41/h11-17,22-23,36H,6-10,18-21H2,1-5H3/p+1 |
| InChIKey | XUQVUIHBTKTODC-UHFFFAOYSA-O |
| XLogP | 6.93 |
| TPSA | 116.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.77 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|