C35H42Cl2KN2O6S2+ — CID 156685332
potassium 4-[(2E)-5-chloro-2-[(2E,4E,6E)-7-[5-chloro-3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonate (PubChem CID 156685332) has the molecular formula C35H42Cl2KN2O6S2+ and a molecular weight of 760.87 g/mol. Its IUPAC name is potassium 4-[(2E)-5-chloro-2-[(2E,4E,6E)-7-[5-chloro-3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonate.
| Compound Name | potassium 4-[(2E)-5-chloro-2-[(2E,4E,6E)-7-[5-chloro-3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 156685332 |
| Molecular Formula | C35H42Cl2KN2O6S2+ |
| Molecular Weight | 760.87 g/mol |
| Exact Mass | 759.15 |
| IUPAC Name | potassium 4-[(2E)-5-chloro-2-[(2E,4E,6E)-7-[5-chloro-3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonate |
| SMILES | CC1(C)C(/C=C/C=C/C=C/C=C2/N(CCCCS(=O)(=O)[O-])c3ccc(Cl)cc3C2(C)C)=[N+](CCCCS(=O)(=O)O)c2ccc(Cl)cc21.[K+] |
| InChI | InChI=1S/C35H42Cl2N2O6S2.K/c1-34(2)28-24-26(36)16-18-30(28)38(20-10-12-22-46(40,41)42)32(34)14-8-6-5-7-9-15-33-35(3,4)29-25-27(37)17-19-31(29)39(33)21-11-13-23-47(43,44)45;/h5-9,14-19,24-25H,10-13,20-23H2,1-4H3,(H-,40,41,42,43,44,45);/q;+1 |
| InChIKey | PPXAJPNUZHGQIG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.87 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|