C35H41N2O8S2- — CID 160745859
3-[(2E)-2-[(2E,4E,6E)-7-[5-carboxy-3,3-dimethyl-1-(3-sulfonatopropyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3,3,5-trimethylindol-1-yl]propane-1-sulfonate (PubChem CID 160745859) has the molecular formula C35H41N2O8S2- and a molecular weight of 681.85 g/mol. Its IUPAC name is 3-[(2E)-2-[(2E,4E,6E)-7-[5-carboxy-3,3-dimethyl-1-(3-sulfonatopropyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3,3,5-trimethylindol-1-yl]propane-1-sulfonate.
| Compound Name | 3-[(2E)-2-[(2E,4E,6E)-7-[5-carboxy-3,3-dimethyl-1-(3-sulfonatopropyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3,3,5-trimethylindol-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 160745859 |
| Molecular Formula | C35H41N2O8S2- |
| Molecular Weight | 681.85 g/mol |
| Exact Mass | 681.23 |
| IUPAC Name | 3-[(2E)-2-[(2E,4E,6E)-7-[5-carboxy-3,3-dimethyl-1-(3-sulfonatopropyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3,3,5-trimethylindol-1-yl]propane-1-sulfonate |
| SMILES | Cc1ccc2c(c1)C(C)(C)/C(=C\C=C\C=C\C=C\C1=[N+](CCCS(=O)(=O)[O-])c3ccc(C(=O)O)cc3C1(C)C)N2CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C35H42N2O8S2/c1-25-15-17-29-27(23-25)34(2,3)31(36(29)19-11-21-46(40,41)42)13-9-7-6-8-10-14-32-35(4,5)28-24-26(33(38)39)16-18-30(28)37(32)20-12-22-47(43,44)45/h6-10,13-18,23-24H,11-12,19-22H2,1-5H3,(H2-,38,39,40,41,42,43,44,45)/p-1 |
| InChIKey | RWEJWBMZCBABFE-UHFFFAOYSA-M |
| XLogP | 5.29 |
| TPSA | 157.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.85 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|