C31H36N2O10S2 — CID 140577262
3-[2-[(E,3E)-3-[5-carboxy-3,3-dimethyl-1-(3-sulfopropyl)indol-2-ylidene]prop-1-enyl]-5-formyloxy-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonate (PubChem CID 140577262) has the molecular formula C31H36N2O10S2 and a molecular weight of 660.77 g/mol. Its IUPAC name is 3-[2-[(E,3E)-3-[5-carboxy-3,3-dimethyl-1-(3-sulfopropyl)indol-2-ylidene]prop-1-enyl]-5-formyloxy-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[(E,3E)-3-[5-carboxy-3,3-dimethyl-1-(3-sulfopropyl)indol-2-ylidene]prop-1-enyl]-5-formyloxy-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 140577262 |
| Molecular Formula | C31H36N2O10S2 |
| Molecular Weight | 660.77 g/mol |
| Exact Mass | 660.18 |
| IUPAC Name | 3-[2-[(E,3E)-3-[5-carboxy-3,3-dimethyl-1-(3-sulfopropyl)indol-2-ylidene]prop-1-enyl]-5-formyloxy-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonate |
| SMILES | CC1(C)C(/C=C/C=C2/N(CCCS(=O)(=O)O)c3ccc(C(=O)O)cc3C2(C)C)=[N+](CCCS(=O)(=O)[O-])c2ccc(OC=O)cc21 |
| InChI | InChI=1S/C31H36N2O10S2/c1-30(2)23-18-21(29(35)36)10-12-25(23)32(14-6-16-44(37,38)39)27(30)8-5-9-28-31(3,4)24-19-22(43-20-34)11-13-26(24)33(28)15-7-17-45(40,41)42/h5,8-13,18-20H,6-7,14-17H2,1-4H3,(H2-,35,36,37,38,39,40,41,42) |
| InChIKey | PGALNXRSUWFTFV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 181.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.77 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|