C32H38N2O11S3 — CID 171765052
3-[(2E)-2-[(2E,4E)-5-[3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-5-formyloxy-3-methyl-3-(sulfomethyl)indol-1-yl]propane-1-sulfonate (PubChem CID 171765052) has the molecular formula C32H38N2O11S3 and a molecular weight of 722.86 g/mol. Its IUPAC name is 3-[(2E)-2-[(2E,4E)-5-[3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-5-formyloxy-3-methyl-3-(sulfomethyl)indol-1-yl]propane-1-sulfonate.
| Compound Name | 3-[(2E)-2-[(2E,4E)-5-[3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-5-formyloxy-3-methyl-3-(sulfomethyl)indol-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 171765052 |
| Molecular Formula | C32H38N2O11S3 |
| Molecular Weight | 722.86 g/mol |
| Exact Mass | 722.16 |
| IUPAC Name | 3-[(2E)-2-[(2E,4E)-5-[3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-5-formyloxy-3-methyl-3-(sulfomethyl)indol-1-yl]propane-1-sulfonate |
| SMILES | CC1(C)C(/C=C/C=C/C=C2/N(CCCS(=O)(=O)[O-])c3ccc(OC=O)cc3C2(C)CS(=O)(=O)O)=[N+](CCCS(=O)(=O)O)c2ccccc21 |
| InChI | InChI=1S/C32H38N2O11S3/c1-31(2)25-11-7-8-12-27(25)33(17-9-19-46(36,37)38)29(31)13-5-4-6-14-30-32(3,22-48(42,43)44)26-21-24(45-23-35)15-16-28(26)34(30)18-10-20-47(39,40)41/h4-8,11-16,21,23H,9-10,17-20,22H2,1-3H3,(H2-,36,37,38,39,40,41,42,43,44) |
| InChIKey | KGMSAOADVNNNFS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 198.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.86 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|