C34H39N2O14S4+ — CID 176555543
(2E)-2-[(E)-3-[1,1-dimethyl-6,8-disulfo-3-(3-sulfopropyl)benzo[e]indol-3-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-sulfopropyl)indole-5-carboxylic acid (PubChem CID 176555543) has the molecular formula C34H39N2O14S4+ and a molecular weight of 827.95 g/mol. Its IUPAC name is (2E)-2-[(E)-3-[1,1-dimethyl-6,8-disulfo-3-(3-sulfopropyl)benzo[e]indol-3-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-sulfopropyl)indole-5-carboxylic acid.
| Compound Name | (2E)-2-[(E)-3-[1,1-dimethyl-6,8-disulfo-3-(3-sulfopropyl)benzo[e]indol-3-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-sulfopropyl)indole-5-carboxylic acid |
|---|---|
| PubChem CID | 176555543 |
| Molecular Formula | C34H39N2O14S4+ |
| Molecular Weight | 827.95 g/mol |
| Exact Mass | 827.13 |
| IUPAC Name | (2E)-2-[(E)-3-[1,1-dimethyl-6,8-disulfo-3-(3-sulfopropyl)benzo[e]indol-3-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-sulfopropyl)indole-5-carboxylic acid |
| SMILES | CC1(C)C(/C=C/C=C2/N(CCCS(=O)(=O)O)c3ccc(C(=O)O)cc3C2(C)C)=[N+](CCCS(=O)(=O)O)c2ccc3c(S(=O)(=O)O)cc(S(=O)(=O)O)cc3c21 |
| InChI | InChI=1S/C34H38N2O14S4/c1-33(2)25-18-21(32(37)38)10-12-26(25)35(14-6-16-51(39,40)41)29(33)8-5-9-30-34(3,4)31-24-19-22(53(45,46)47)20-28(54(48,49)50)23(24)11-13-27(31)36(30)15-7-17-52(42,43)44/h5,8-13,18-20H,6-7,14-17H2,1-4H3,(H4-,37,38,39,40,41,42,43,44,45,46,47,48,49,50)/p+1 |
| InChIKey | FXVJKARKRJYBTI-UHFFFAOYSA-O |
| XLogP | 4.20 |
| TPSA | 261.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.95 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|