C35H44N3O15S5+ — CID 148914713
2-[3-[5-amino-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-2-yl]prop-2-enylidene]-1-methyl-1,3-bis(3-sulfopropyl)benzo[e]indole-6,8-disulfonic acid (PubChem CID 148914713) has the molecular formula C35H44N3O15S5+ and a molecular weight of 907.08 g/mol. Its IUPAC name is 2-[3-[5-amino-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-2-yl]prop-2-enylidene]-1-methyl-1,3-bis(3-sulfopropyl)benzo[e]indole-6,8-disulfonic acid.
| Compound Name | 2-[3-[5-amino-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-2-yl]prop-2-enylidene]-1-methyl-1,3-bis(3-sulfopropyl)benzo[e]indole-6,8-disulfonic acid |
|---|---|
| PubChem CID | 148914713 |
| Molecular Formula | C35H44N3O15S5+ |
| Molecular Weight | 907.08 g/mol |
| Exact Mass | 906.14 |
| IUPAC Name | 2-[3-[5-amino-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-2-yl]prop-2-enylidene]-1-methyl-1,3-bis(3-sulfopropyl)benzo[e]indole-6,8-disulfonic acid |
| SMILES | CC1(C)C(C=CC=C2N(CCCS(=O)(=O)O)c3ccc4c(S(=O)(=O)O)cc(S(=O)(=O)O)cc4c3C2(C)CCCS(=O)(=O)O)=[N+](CCCS(=O)(=O)O)c2ccc(N)cc21 |
| InChI | InChI=1S/C35H43N3O15S5/c1-34(2)27-20-23(36)10-12-28(27)37(15-6-18-55(42,43)44)31(34)8-4-9-32-35(3,14-5-17-54(39,40)41)33-26-21-24(57(48,49)50)22-30(58(51,52)53)25(26)11-13-29(33)38(32)16-7-19-56(45,46)47/h4,8-13,20-22H,5-7,14-19,36H2,1-3H3,(H4-,39,40,41,42,43,44,45,46,47,48,49,50,51,52,53)/p+1 |
| InChIKey | PJHXIQUBSKRBKD-UHFFFAOYSA-O |
| XLogP | 3.73 |
| TPSA | 304.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.08 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|