C41H45BrN2 — CID 66572090
(2E)-2-[(E)-3-[3,3-dimethyl-1-(3-phenylpropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-phenylpropyl)indole bromide (PubChem CID 66572090) has the molecular formula C41H45BrN2 and a molecular weight of 645.73 g/mol. Its IUPAC name is (2E)-2-[(E)-3-[3,3-dimethyl-1-(3-phenylpropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-phenylpropyl)indole bromide.
| Compound Name | (2E)-2-[(E)-3-[3,3-dimethyl-1-(3-phenylpropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-phenylpropyl)indole bromide |
|---|---|
| PubChem CID | 66572090 |
| Molecular Formula | C41H45BrN2 |
| Molecular Weight | 645.73 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | (2E)-2-[(E)-3-[3,3-dimethyl-1-(3-phenylpropyl)indol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-1-(3-phenylpropyl)indole bromide |
| SMILES | CC1(C)C(/C=C/C=C2/N(CCCc3ccccc3)c3ccccc3C2(C)C)=[N+](CCCc2ccccc2)c2ccccc21.[Br-] |
| InChI | InChI=1S/C41H45N2.BrH/c1-40(2)34-24-11-13-26-36(34)42(30-16-22-32-18-7-5-8-19-32)38(40)28-15-29-39-41(3,4)35-25-12-14-27-37(35)43(39)31-17-23-33-20-9-6-10-21-33;/h5-15,18-21,24-29H,16-17,22-23,30-31H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | ZJBJPSWQWWNTHT-UHFFFAOYSA-M |
| XLogP | 6.57 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.73 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|