C30H38N3O3+ — CID 161410432
2-[(E,3E)-3-[5-methoxy-3,3-dimethyl-1-(3-methylbutyl)indol-2-ylidene]prop-1-enyl]-1,3,3-trimethyl-5-nitroindol-1-ium (PubChem CID 161410432) has the molecular formula C30H38N3O3+ and a molecular weight of 488.65 g/mol. Its IUPAC name is 2-[(E,3E)-3-[5-methoxy-3,3-dimethyl-1-(3-methylbutyl)indol-2-ylidene]prop-1-enyl]-1,3,3-trimethyl-5-nitroindol-1-ium.
| Compound Name | 2-[(E,3E)-3-[5-methoxy-3,3-dimethyl-1-(3-methylbutyl)indol-2-ylidene]prop-1-enyl]-1,3,3-trimethyl-5-nitroindol-1-ium |
|---|---|
| PubChem CID | 161410432 |
| Molecular Formula | C30H38N3O3+ |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 2-[(E,3E)-3-[5-methoxy-3,3-dimethyl-1-(3-methylbutyl)indol-2-ylidene]prop-1-enyl]-1,3,3-trimethyl-5-nitroindol-1-ium |
| SMILES | COc1ccc2c(c1)C(C)(C)/C(=C\C=C\C1=[N+](C)c3ccc([N+](=O)[O-])cc3C1(C)C)N2CCC(C)C |
| InChI | InChI=1S/C30H38N3O3/c1-20(2)16-17-32-26-15-13-22(36-8)19-24(26)30(5,6)28(32)11-9-10-27-29(3,4)23-18-21(33(34)35)12-14-25(23)31(27)7/h9-15,18-20H,16-17H2,1-8H3/q+1 |
| InChIKey | XNSRGERQXXJVJT-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|