C20H26N3O2S+ — CID 58160842
2-[(E,3E)-3-(3,3-dimethyl-5-nitro-1-propylindol-2-ylidene)prop-1-enyl]-3-methyl-4,5-dihydro-1,3-thiazol-3-ium (PubChem CID 58160842) has the molecular formula C20H26N3O2S+ and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-[(E,3E)-3-(3,3-dimethyl-5-nitro-1-propylindol-2-ylidene)prop-1-enyl]-3-methyl-4,5-dihydro-1,3-thiazol-3-ium.
| Compound Name | 2-[(E,3E)-3-(3,3-dimethyl-5-nitro-1-propylindol-2-ylidene)prop-1-enyl]-3-methyl-4,5-dihydro-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 58160842 |
| Molecular Formula | C20H26N3O2S+ |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-[(E,3E)-3-(3,3-dimethyl-5-nitro-1-propylindol-2-ylidene)prop-1-enyl]-3-methyl-4,5-dihydro-1,3-thiazol-3-ium |
| SMILES | CCCN1/C(=C/C=C/C2=[N+](C)CCS2)C(C)(C)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C20H26N3O2S/c1-5-11-22-17-10-9-15(23(24)25)14-16(17)20(2,3)18(22)7-6-8-19-21(4)12-13-26-19/h6-10,14H,5,11-13H2,1-4H3/q+1 |
| InChIKey | KOLFMRUZZOEAQU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|