C27H31Cl2N4O5S+ — CID 177384744
3-[(2E)-2-[(E)-3-(5,6-dichloro-1,3-diethylbenzimidazol-3-ium-2-yl)prop-2-enylidene]-3,3-dimethyl-5-nitroindol-1-yl]propane-1-sulfonic acid (PubChem CID 177384744) has the molecular formula C27H31Cl2N4O5S+ and a molecular weight of 594.54 g/mol. Its IUPAC name is 3-[(2E)-2-[(E)-3-(5,6-dichloro-1,3-diethylbenzimidazol-3-ium-2-yl)prop-2-enylidene]-3,3-dimethyl-5-nitroindol-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(2E)-2-[(E)-3-(5,6-dichloro-1,3-diethylbenzimidazol-3-ium-2-yl)prop-2-enylidene]-3,3-dimethyl-5-nitroindol-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 177384744 |
| Molecular Formula | C27H31Cl2N4O5S+ |
| Molecular Weight | 594.54 g/mol |
| Exact Mass | 593.14 |
| IUPAC Name | 3-[(2E)-2-[(E)-3-(5,6-dichloro-1,3-diethylbenzimidazol-3-ium-2-yl)prop-2-enylidene]-3,3-dimethyl-5-nitroindol-1-yl]propane-1-sulfonic acid |
| SMILES | CCn1c(/C=C/C=C2/N(CCCS(=O)(=O)O)c3ccc([N+](=O)[O-])cc3C2(C)C)[n+](CC)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C27H30Cl2N4O5S/c1-5-30-23-16-20(28)21(29)17-24(23)31(6-2)26(30)10-7-9-25-27(3,4)19-15-18(33(34)35)11-12-22(19)32(25)13-8-14-39(36,37)38/h7,9-12,15-17H,5-6,8,13-14H2,1-4H3/p+1 |
| InChIKey | JGDGUTSOGYDUEX-UHFFFAOYSA-O |
| XLogP | 6.16 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.54 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|