C28H32Cl2N4O8S2 — CID 177447628
3-[(2E)-2-[(E)-3-[5,6-dichloro-1-ethyl-3-(3-sulfopropyl)benzimidazol-3-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-5-nitroindol-1-yl]propane-1-sulfonate (PubChem CID 177447628) has the molecular formula C28H32Cl2N4O8S2 and a molecular weight of 687.62 g/mol. Its IUPAC name is 3-[(2E)-2-[(E)-3-[5,6-dichloro-1-ethyl-3-(3-sulfopropyl)benzimidazol-3-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-5-nitroindol-1-yl]propane-1-sulfonate.
| Compound Name | 3-[(2E)-2-[(E)-3-[5,6-dichloro-1-ethyl-3-(3-sulfopropyl)benzimidazol-3-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-5-nitroindol-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 177447628 |
| Molecular Formula | C28H32Cl2N4O8S2 |
| Molecular Weight | 687.62 g/mol |
| Exact Mass | 686.10 |
| IUPAC Name | 3-[(2E)-2-[(E)-3-[5,6-dichloro-1-ethyl-3-(3-sulfopropyl)benzimidazol-3-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-5-nitroindol-1-yl]propane-1-sulfonate |
| SMILES | CCn1c(/C=C/C=C2/N(CCCS(=O)(=O)[O-])c3ccc([N+](=O)[O-])cc3C2(C)C)[n+](CCCS(=O)(=O)O)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C28H32Cl2N4O8S2/c1-4-31-24-17-21(29)22(30)18-25(24)33(13-7-15-44(40,41)42)27(31)9-5-8-26-28(2,3)20-16-19(34(35)36)10-11-23(20)32(26)12-6-14-43(37,38)39/h5,8-11,16-18H,4,6-7,12-15H2,1-3H3,(H-,37,38,39,40,41,42) |
| InChIKey | FURGHXYTEUVELE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 166.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|