C32H38Cl2N4O7S — CID 4246950
3-[5-chloro-2-[3-(5-chloro-6-ethoxycarbonyl-1,3-diethylbenzimidazol-2-ylidene)prop-1-enyl]-6-ethoxycarbonyl-3-ethylbenzimidazol-1-ium-1-yl]propane-1-sulfonate (PubChem CID 4246950) has the molecular formula C32H38Cl2N4O7S and a molecular weight of 693.65 g/mol. Its IUPAC name is 3-[5-chloro-2-[3-(5-chloro-6-ethoxycarbonyl-1,3-diethylbenzimidazol-2-ylidene)prop-1-enyl]-6-ethoxycarbonyl-3-ethylbenzimidazol-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[5-chloro-2-[3-(5-chloro-6-ethoxycarbonyl-1,3-diethylbenzimidazol-2-ylidene)prop-1-enyl]-6-ethoxycarbonyl-3-ethylbenzimidazol-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 4246950 |
| Molecular Formula | C32H38Cl2N4O7S |
| Molecular Weight | 693.65 g/mol |
| Exact Mass | 692.18 |
| IUPAC Name | 3-[5-chloro-2-[3-(5-chloro-6-ethoxycarbonyl-1,3-diethylbenzimidazol-2-ylidene)prop-1-enyl]-6-ethoxycarbonyl-3-ethylbenzimidazol-1-ium-1-yl]propane-1-sulfonate |
| SMILES | CCOC(=O)c1cc2c(cc1Cl)N(CC)C(=CC=Cc1n(CC)c3cc(Cl)c(C(=O)OCC)cc3[n+]1CCCS(=O)(=O)[O-])N2CC |
| InChI | InChI=1S/C32H38Cl2N4O7S/c1-6-35-25-17-21(31(39)44-9-4)23(33)19-27(25)36(7-2)29(35)13-11-14-30-37(8-3)28-20-24(34)22(32(40)45-10-5)18-26(28)38(30)15-12-16-46(41,42)43/h11,13-14,17-20H,6-10,12,15-16H2,1-5H3 |
| InChIKey | BTKKNYZHMUGNJU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 125.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.65 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|