C27H29Cl2F4N4O6S2+ — CID 59973633
4-[5-chloro-2-[3-[6-chloro-1-ethyl-5-fluoro-3-(sulfomethyl)benzimidazol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-6-(trifluoromethyl)benzimidazol-1-yl]butane-1-sulfonic acid (PubChem CID 59973633) has the molecular formula C27H29Cl2F4N4O6S2+ and a molecular weight of 716.58 g/mol. Its IUPAC name is 4-[5-chloro-2-[3-[6-chloro-1-ethyl-5-fluoro-3-(sulfomethyl)benzimidazol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-6-(trifluoromethyl)benzimidazol-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[5-chloro-2-[3-[6-chloro-1-ethyl-5-fluoro-3-(sulfomethyl)benzimidazol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-6-(trifluoromethyl)benzimidazol-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 59973633 |
| Molecular Formula | C27H29Cl2F4N4O6S2+ |
| Molecular Weight | 716.58 g/mol |
| Exact Mass | 715.08 |
| IUPAC Name | 4-[5-chloro-2-[3-[6-chloro-1-ethyl-5-fluoro-3-(sulfomethyl)benzimidazol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-6-(trifluoromethyl)benzimidazol-1-yl]butane-1-sulfonic acid |
| SMILES | CCN1C(=CC=Cc2n(CC)c3cc(Cl)c(F)cc3[n+]2CS(=O)(=O)O)N(CCCCS(=O)(=O)O)c2cc(C(F)(F)F)c(Cl)cc21 |
| InChI | InChI=1S/C27H28Cl2F4N4O6S2/c1-3-34-22-13-18(28)17(27(31,32)33)12-21(22)36(10-5-6-11-44(38,39)40)25(34)8-7-9-26-35(4-2)23-14-19(29)20(30)15-24(23)37(26)16-45(41,42)43/h7-9,12-15H,3-6,10-11,16H2,1-2H3,(H-,38,39,40,41,42,43)/p+1 |
| InChIKey | MSDWLFSLUBCYFX-UHFFFAOYSA-O |
| XLogP | 6.13 |
| TPSA | 124.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.58 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|