C33H41Cl4N4O3S+ — CID 140867885
4-[(2Z)-5,6-dichloro-2-[(2E,4E)-5-(5,6-dichloro-1-ethyl-3-hexylbenzimidazol-3-ium-2-yl)penta-2,4-dienylidene]-3-ethylbenzimidazol-1-yl]butane-1-sulfonic acid (PubChem CID 140867885) has the molecular formula C33H41Cl4N4O3S+ and a molecular weight of 715.60 g/mol. Its IUPAC name is 4-[(2Z)-5,6-dichloro-2-[(2E,4E)-5-(5,6-dichloro-1-ethyl-3-hexylbenzimidazol-3-ium-2-yl)penta-2,4-dienylidene]-3-ethylbenzimidazol-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[(2Z)-5,6-dichloro-2-[(2E,4E)-5-(5,6-dichloro-1-ethyl-3-hexylbenzimidazol-3-ium-2-yl)penta-2,4-dienylidene]-3-ethylbenzimidazol-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 140867885 |
| Molecular Formula | C33H41Cl4N4O3S+ |
| Molecular Weight | 715.60 g/mol |
| Exact Mass | 713.16 |
| IUPAC Name | 4-[(2Z)-5,6-dichloro-2-[(2E,4E)-5-(5,6-dichloro-1-ethyl-3-hexylbenzimidazol-3-ium-2-yl)penta-2,4-dienylidene]-3-ethylbenzimidazol-1-yl]butane-1-sulfonic acid |
| SMILES | CCCCCC[n+]1c(/C=C/C=C/C=C2/N(CC)c3cc(Cl)c(Cl)cc3N2CCCCS(=O)(=O)O)n(CC)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C33H40Cl4N4O3S/c1-4-7-8-12-17-40-30-22-26(36)24(34)20-28(30)38(5-2)32(40)15-10-9-11-16-33-39(6-3)29-21-25(35)27(37)23-31(29)41(33)18-13-14-19-45(42,43)44/h9-11,15-16,20-23H,4-8,12-14,17-19H2,1-3H3/p+1 |
| InChIKey | QVBGXOKJJLUHPN-UHFFFAOYSA-O |
| XLogP | 9.57 |
| TPSA | 69.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.60 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|