C37H46Cl4N4O4 — CID 10897965
2-[2-[(E,3E)-3-[1-(carboxymethyl)-5,6-dichloro-3-octylbenzimidazol-2-ylidene]prop-1-enyl]-5,6-dichloro-3-octylbenzimidazol-1-ium-1-yl]acetate (PubChem CID 10897965) has the molecular formula C37H46Cl4N4O4 and a molecular weight of 752.61 g/mol. Its IUPAC name is 2-[2-[(E,3E)-3-[1-(carboxymethyl)-5,6-dichloro-3-octylbenzimidazol-2-ylidene]prop-1-enyl]-5,6-dichloro-3-octylbenzimidazol-1-ium-1-yl]acetate.
| Compound Name | 2-[2-[(E,3E)-3-[1-(carboxymethyl)-5,6-dichloro-3-octylbenzimidazol-2-ylidene]prop-1-enyl]-5,6-dichloro-3-octylbenzimidazol-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 10897965 |
| Molecular Formula | C37H46Cl4N4O4 |
| Molecular Weight | 752.61 g/mol |
| Exact Mass | 750.23 |
| IUPAC Name | 2-[2-[(E,3E)-3-[1-(carboxymethyl)-5,6-dichloro-3-octylbenzimidazol-2-ylidene]prop-1-enyl]-5,6-dichloro-3-octylbenzimidazol-1-ium-1-yl]acetate |
| SMILES | CCCCCCCCN1/C(=C\C=C\c2n(CCCCCCCC)c3cc(Cl)c(Cl)cc3[n+]2CC(=O)[O-])N(CC(=O)O)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C37H46Cl4N4O4/c1-3-5-7-9-11-13-18-42-30-20-26(38)28(40)22-32(30)44(24-36(46)47)34(42)16-15-17-35-43(19-14-12-10-8-6-4-2)31-21-27(39)29(41)23-33(31)45(35)25-37(48)49/h15-17,20-23H,3-14,18-19,24-25H2,1-2H3,(H-,46,47,48,49) |
| InChIKey | IENJXZLFEYTMQF-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 92.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.61 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|